C13H12BrN3O3S — CID 79706195
2-[1-[(2-amino-4-bromobenzoyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 79706195) has the molecular formula C13H12BrN3O3S and a molecular weight of 370.23 g/mol. Its IUPAC name is 2-[1-[(2-amino-4-bromobenzoyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[1-[(2-amino-4-bromobenzoyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 79706195 |
| Molecular Formula | C13H12BrN3O3S |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 2-[1-[(2-amino-4-bromobenzoyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(NC(=O)c1ccc(Br)cc1N)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C13H12BrN3O3S/c1-6(12-17-10(5-21-12)13(19)20)16-11(18)8-3-2-7(14)4-9(8)15/h2-6H,15H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | CWULJQASQCAPPG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|