C13H10Br2N2O3S — CID 114368127
2-[1-[(2,5-dibromobenzoyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 114368127) has the molecular formula C13H10Br2N2O3S and a molecular weight of 434.11 g/mol. Its IUPAC name is 2-[1-[(2,5-dibromobenzoyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[1-[(2,5-dibromobenzoyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114368127 |
| Molecular Formula | C13H10Br2N2O3S |
| Molecular Weight | 434.11 g/mol |
| Exact Mass | 431.88 |
| IUPAC Name | 2-[1-[(2,5-dibromobenzoyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(NC(=O)c1cc(Br)ccc1Br)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C13H10Br2N2O3S/c1-6(12-17-10(5-21-12)13(19)20)16-11(18)8-4-7(14)2-3-9(8)15/h2-6H,1H3,(H,16,18)(H,19,20) |
| InChIKey | AOIQYMKHGXTQPI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.11 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |