C15H15BrClNOS — CID 107951852
3-bromo-5-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]benzamide (PubChem CID 107951852) has the molecular formula C15H15BrClNOS and a molecular weight of 372.72 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]benzamide.
| Compound Name | 3-bromo-5-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 107951852 |
| Molecular Formula | C15H15BrClNOS |
| Molecular Weight | 372.72 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | 3-bromo-5-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]benzamide |
| SMILES | Cc1cc(C(C)NC(=O)c2cc(Cl)cc(Br)c2)c(C)s1 |
| InChI | InChI=1S/C15H15BrClNOS/c1-8-4-14(10(3)20-8)9(2)18-15(19)11-5-12(16)7-13(17)6-11/h4-7,9H,1-3H3,(H,18,19) |
| InChIKey | IWDASDIZJREIMG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.72 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |