C18H20Br2O — CID 107955363
(2,4-dibromophenyl)-(2,3,4,5,6-pentamethylphenyl)methanol (PubChem CID 107955363) has the molecular formula C18H20Br2O and a molecular weight of 412.17 g/mol. Its IUPAC name is (2,4-dibromophenyl)-(2,3,4,5,6-pentamethylphenyl)methanol.
| Compound Name | (2,4-dibromophenyl)-(2,3,4,5,6-pentamethylphenyl)methanol |
|---|---|
| PubChem CID | 107955363 |
| Molecular Formula | C18H20Br2O |
| Molecular Weight | 412.17 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | (2,4-dibromophenyl)-(2,3,4,5,6-pentamethylphenyl)methanol |
| SMILES | Cc1c(C)c(C)c(C(O)c2ccc(Br)cc2Br)c(C)c1C |
| InChI | InChI=1S/C18H20Br2O/c1-9-10(2)12(4)17(13(5)11(9)3)18(21)15-7-6-14(19)8-16(15)20/h6-8,18,21H,1-5H3 |
| InChIKey | YDCHQXKTDRIUDV-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.17 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |