C10H10Br2O — CID 107947627
1-(2,4-dibromophenyl)-2-methylprop-2-en-1-ol (PubChem CID 107947627) has the molecular formula C10H10Br2O and a molecular weight of 306.00 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-2-methylprop-2-en-1-ol.
| Compound Name | 1-(2,4-dibromophenyl)-2-methylprop-2-en-1-ol |
|---|---|
| PubChem CID | 107947627 |
| Molecular Formula | C10H10Br2O |
| Molecular Weight | 306.00 g/mol |
| Exact Mass | 303.91 |
| IUPAC Name | 1-(2,4-dibromophenyl)-2-methylprop-2-en-1-ol |
| SMILES | C=C(C)C(O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C10H10Br2O/c1-6(2)10(13)8-4-3-7(11)5-9(8)12/h3-5,10,13H,1H2,2H3 |
| InChIKey | CRIDEPAIPGOZTA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.00 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|