C9H10Br2O2 — CID 72706043
2,4-dibromo-1-(dimethoxymethyl)benzene (PubChem CID 72706043) has the molecular formula C9H10Br2O2 and a molecular weight of 309.99 g/mol. Its IUPAC name is 2,4-dibromo-1-(dimethoxymethyl)benzene.
| Compound Name | 2,4-dibromo-1-(dimethoxymethyl)benzene |
|---|---|
| PubChem CID | 72706043 |
| Molecular Formula | C9H10Br2O2 |
| Molecular Weight | 309.99 g/mol |
| Exact Mass | 307.90 |
| IUPAC Name | 2,4-dibromo-1-(dimethoxymethyl)benzene |
| SMILES | COC(OC)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C9H10Br2O2/c1-12-9(13-2)7-4-3-6(10)5-8(7)11/h3-5,9H,1-2H3 |
| InChIKey | UXVWMCQDSXCBBQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.99 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|