C9H8Br2O — CID 107957829
1-(2,4-dibromophenyl)cyclopropan-1-ol (PubChem CID 107957829) has the molecular formula C9H8Br2O and a molecular weight of 291.97 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)cyclopropan-1-ol.
| Compound Name | 1-(2,4-dibromophenyl)cyclopropan-1-ol |
|---|---|
| PubChem CID | 107957829 |
| Molecular Formula | C9H8Br2O |
| Molecular Weight | 291.97 g/mol |
| Exact Mass | 289.89 |
| IUPAC Name | 1-(2,4-dibromophenyl)cyclopropan-1-ol |
| SMILES | OC1(c2ccc(Br)cc2Br)CC1 |
| InChI | InChI=1S/C9H8Br2O/c10-6-1-2-7(8(11)5-6)9(12)3-4-9/h1-2,5,12H,3-4H2 |
| InChIKey | FONLBFPQOTXCLG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.97 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |