C10H9Br2NS2 — CID 107962803
1-(2,5-dibromothiophen-3-yl)-2-thiophen-3-ylethanamine (PubChem CID 107962803) has the molecular formula C10H9Br2NS2 and a molecular weight of 367.13 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2-thiophen-3-ylethanamine.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 107962803 |
| Molecular Formula | C10H9Br2NS2 |
| Molecular Weight | 367.13 g/mol |
| Exact Mass | 364.85 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2-thiophen-3-ylethanamine |
| SMILES | NC(Cc1ccsc1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C10H9Br2NS2/c11-9-4-7(10(12)15-9)8(13)3-6-1-2-14-5-6/h1-2,4-5,8H,3,13H2 |
| InChIKey | RHNIEHJVAMVRAA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.13 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |