C12H9Br2F2NS — CID 107969352
1-(2,5-dibromothiophen-3-yl)-2-(3,5-difluorophenyl)ethanamine (PubChem CID 107969352) has the molecular formula C12H9Br2F2NS and a molecular weight of 397.08 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2-(3,5-difluorophenyl)ethanamine.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2-(3,5-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 107969352 |
| Molecular Formula | C12H9Br2F2NS |
| Molecular Weight | 397.08 g/mol |
| Exact Mass | 394.88 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2-(3,5-difluorophenyl)ethanamine |
| SMILES | NC(Cc1cc(F)cc(F)c1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C12H9Br2F2NS/c13-11-5-9(12(14)18-11)10(17)3-6-1-7(15)4-8(16)2-6/h1-2,4-5,10H,3,17H2 |
| InChIKey | OSWDKWOUUAFZRQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.08 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |