C13H14ClNS — CID 82883386
1-(5-chloro-2-methylphenyl)-2-thiophen-3-ylethanamine (PubChem CID 82883386) has the molecular formula C13H14ClNS and a molecular weight of 251.78 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-2-thiophen-3-ylethanamine.
| Compound Name | 1-(5-chloro-2-methylphenyl)-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 82883386 |
| Molecular Formula | C13H14ClNS |
| Molecular Weight | 251.78 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-2-thiophen-3-ylethanamine |
| SMILES | Cc1ccc(Cl)cc1C(N)Cc1ccsc1 |
| InChI | InChI=1S/C13H14ClNS/c1-9-2-3-11(14)7-12(9)13(15)6-10-4-5-16-8-10/h2-5,7-8,13H,6,15H2,1H3 |
| InChIKey | XPPYDHFSIDNTKA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.78 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |