C19H18ClN — CID 82871275
1-(5-chloro-2-methylphenyl)-2-naphthalen-2-ylethanamine (PubChem CID 82871275) has the molecular formula C19H18ClN and a molecular weight of 295.81 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-2-naphthalen-2-ylethanamine.
| Compound Name | 1-(5-chloro-2-methylphenyl)-2-naphthalen-2-ylethanamine |
|---|---|
| PubChem CID | 82871275 |
| Molecular Formula | C19H18ClN |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-2-naphthalen-2-ylethanamine |
| SMILES | Cc1ccc(Cl)cc1C(N)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H18ClN/c1-13-6-9-17(20)12-18(13)19(21)11-14-7-8-15-4-2-3-5-16(15)10-14/h2-10,12,19H,11,21H2,1H3 |
| InChIKey | RXLOEDBIYJDUKJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |