C13H8Cl2N2O2S — CID 107963386
2-[2-(2,5-dichlorothiophen-3-yl)benzimidazol-1-yl]acetic acid (PubChem CID 107963386) has the molecular formula C13H8Cl2N2O2S and a molecular weight of 327.19 g/mol. Its IUPAC name is 2-[2-(2,5-dichlorothiophen-3-yl)benzimidazol-1-yl]acetic acid.
| Compound Name | 2-[2-(2,5-dichlorothiophen-3-yl)benzimidazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 107963386 |
| Molecular Formula | C13H8Cl2N2O2S |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 2-[2-(2,5-dichlorothiophen-3-yl)benzimidazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1c(-c2cc(Cl)sc2Cl)nc2ccccc21 |
| InChI | InChI=1S/C13H8Cl2N2O2S/c14-10-5-7(12(15)20-10)13-16-8-3-1-2-4-9(8)17(13)6-11(18)19/h1-5H,6H2,(H,18,19) |
| InChIKey | VRJZZSMGCLTNNC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |