2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid

C15H14N2O2S — CID 65238724

IUPAC2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid
SMILESCc1cc(-c2nc3ccccc3n2CC(=O)O)sc1C
InChIInChI=1S/C15H14N2O2S/c1-9-7-13(20-10(9)2)15-16-11-5-3-4-6-12(11)17(15)8-14(18)19/h3-7H,8H2,1-2H3,(H,18,19)
InChIKeyGRPYHPMTICAPHN-UHFFFAOYSA-N
MW286.36 g/mol
LogP3.47
Rot. Bonds3

About 2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid

2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid (PubChem CID 65238724) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid
PubChem CID65238724
Molecular FormulaC15H14N2O2S
Molecular Weight286.36 g/mol
Exact Mass286.08
IUPAC Name2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid
SMILESCc1cc(-c2nc3ccccc3n2CC(=O)O)sc1C
InChIInChI=1S/C15H14N2O2S/c1-9-7-13(20-10(9)2)15-16-11-5-3-4-6-12(11)17(15)8-14(18)19/h3-7H,8H2,1-2H3,(H,18,19)
InChIKeyGRPYHPMTICAPHN-UHFFFAOYSA-N
XLogP3.47
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.36
LogP ≤ 53.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid?
The IUPAC name of 2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid (CID 65238724) is 2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid.
What is the SMILES notation for 2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid?
The canonical SMILES for 2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid is Cc1cc(-c2nc3ccccc3n2CC(=O)O)sc1C.
What is the InChIKey of 2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid?
The InChIKey is GRPYHPMTICAPHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2S/c1-9-7-13(20-10(9)2)15-16-11-5-3-4-6-12(11)17(15)8-14(18)19/h3-7H,8H2,1-2H3,(H,18,19).
What are the key properties of 2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid?
2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid has a molecular weight of 286.36 g/mol, XLogP of 3.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid is sourced from PubChem (CID 65238724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).