C15H14N2O2S — CID 65238724
2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid (PubChem CID 65238724) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid.
| Compound Name | 2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 65238724 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-[2-(4,5-dimethylthiophen-2-yl)benzimidazol-1-yl]acetic acid |
| SMILES | Cc1cc(-c2nc3ccccc3n2CC(=O)O)sc1C |
| InChI | InChI=1S/C15H14N2O2S/c1-9-7-13(20-10(9)2)15-16-11-5-3-4-6-12(11)17(15)8-14(18)19/h3-7H,8H2,1-2H3,(H,18,19) |
| InChIKey | GRPYHPMTICAPHN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |