C17H12Br2OS — CID 107964114
(2,5-dibromothiophen-3-yl)-(4-phenylphenyl)methanol (PubChem CID 107964114) has the molecular formula C17H12Br2OS and a molecular weight of 424.16 g/mol. Its IUPAC name is (2,5-dibromothiophen-3-yl)-(4-phenylphenyl)methanol.
| Compound Name | (2,5-dibromothiophen-3-yl)-(4-phenylphenyl)methanol |
|---|---|
| PubChem CID | 107964114 |
| Molecular Formula | C17H12Br2OS |
| Molecular Weight | 424.16 g/mol |
| Exact Mass | 421.90 |
| IUPAC Name | (2,5-dibromothiophen-3-yl)-(4-phenylphenyl)methanol |
| SMILES | OC(c1ccc(-c2ccccc2)cc1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C17H12Br2OS/c18-15-10-14(17(19)21-15)16(20)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-10,16,20H |
| InChIKey | SMAIDTCIRONVGI-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.16 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |