C13H17BrN2O2S — CID 107966754
3-[5-(5-bromothiophen-3-yl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)propan-1-amine (PubChem CID 107966754) has the molecular formula C13H17BrN2O2S and a molecular weight of 345.26 g/mol. Its IUPAC name is 3-[5-(5-bromothiophen-3-yl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)propan-1-amine.
| Compound Name | 3-[5-(5-bromothiophen-3-yl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)propan-1-amine |
|---|---|
| PubChem CID | 107966754 |
| Molecular Formula | C13H17BrN2O2S |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 3-[5-(5-bromothiophen-3-yl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)propan-1-amine |
| SMILES | COCCNCCCc1ncc(-c2csc(Br)c2)o1 |
| InChI | InChI=1S/C13H17BrN2O2S/c1-17-6-5-15-4-2-3-13-16-8-11(18-13)10-7-12(14)19-9-10/h7-9,15H,2-6H2,1H3 |
| InChIKey | SDTNGMPIHYDUDD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|