C13H14Br2N2O2 — CID 107975815
N-[[5-(3,5-dibromophenyl)-1,3-oxazol-2-yl]methyl]-2-methoxyethanamine (PubChem CID 107975815) has the molecular formula C13H14Br2N2O2 and a molecular weight of 390.08 g/mol. Its IUPAC name is N-[[5-(3,5-dibromophenyl)-1,3-oxazol-2-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-(3,5-dibromophenyl)-1,3-oxazol-2-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 107975815 |
| Molecular Formula | C13H14Br2N2O2 |
| Molecular Weight | 390.08 g/mol |
| Exact Mass | 387.94 |
| IUPAC Name | N-[[5-(3,5-dibromophenyl)-1,3-oxazol-2-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1ncc(-c2cc(Br)cc(Br)c2)o1 |
| InChI | InChI=1S/C13H14Br2N2O2/c1-18-3-2-16-8-13-17-7-12(19-13)9-4-10(14)6-11(15)5-9/h4-7,16H,2-3,8H2,1H3 |
| InChIKey | DAPACKQJUDSEMY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.08 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|