C9H12O2 — CID 10796931
3,4,4a,5,6,7-hexahydrochromen-2-one (PubChem CID 10796931) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 3,4,4a,5,6,7-hexahydrochromen-2-one.
| Compound Name | 3,4,4a,5,6,7-hexahydrochromen-2-one |
|---|---|
| PubChem CID | 10796931 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 3,4,4a,5,6,7-hexahydrochromen-2-one |
| SMILES | O=C1CCC2CCCC=C2O1 |
| InChI | InChI=1S/C9H12O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h4,7H,1-3,5-6H2 |
| InChIKey | NBQYFMKBZLSPIY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |