About (3R)-3-methyl-3,4,5,6-tetrahydro-2H-azepin-7-amine
(3R)-3-methyl-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 10797080) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is (3R)-3-methyl-3,4,5,6-tetrahydro-2H-azepin-7-amine.
Analyze (3R)-3-methyl-3,4,5,6-tetrahydro-2H-azepin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-methyl-3,4,5,6-tetrahydro-2H-azepin-7-amine?
The IUPAC name of (3R)-3-methyl-3,4,5,6-tetrahydro-2H-azepin-7-amine (CID 10797080) is (3R)-3-methyl-3,4,5,6-tetrahydro-2H-azepin-7-amine.
What is the SMILES notation for (3R)-3-methyl-3,4,5,6-tetrahydro-2H-azepin-7-amine?
The canonical SMILES for (3R)-3-methyl-3,4,5,6-tetrahydro-2H-azepin-7-amine is C[C@@H]1CCCC(N)=NC1.
What is the InChIKey of (3R)-3-methyl-3,4,5,6-tetrahydro-2H-azepin-7-amine?
The InChIKey is LMQWSKBESDEHJC-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H14N2/c1-6-3-2-4-7(8)9-5-6/h6H,2-5H2,1H3,(H2,8,9)/t6-/m1/s1.
What are the key properties of (3R)-3-methyl-3,4,5,6-tetrahydro-2H-azepin-7-amine?
(3R)-3-methyl-3,4,5,6-tetrahydro-2H-azepin-7-amine has a molecular weight of 126.20 g/mol, XLogP of 1.16, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-methyl-3,4,5,6-tetrahydro-2H-azepin-7-amine is sourced from PubChem (CID 10797080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).