C12H20O3 — CID 10798599
(3aS,6aR)-2-cyclohexyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-ol (PubChem CID 10798599) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (3aS,6aR)-2-cyclohexyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-ol.
| Compound Name | (3aS,6aR)-2-cyclohexyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-ol |
|---|---|
| PubChem CID | 10798599 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (3aS,6aR)-2-cyclohexyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-ol |
| SMILES | OC1C[C@@H]2CC(C3CCCCC3)O[C@@H]2O1 |
| InChI | InChI=1S/C12H20O3/c13-11-7-9-6-10(14-12(9)15-11)8-4-2-1-3-5-8/h8-13H,1-7H2/t9-,10?,11?,12+/m0/s1 |
| InChIKey | BTOOMMSARUJSAL-WNYYMSAVSA-N |
| XLogP | 2.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |