C12H14ClFN2OS — CID 107987793
N-(1-amino-1-sulfanylidenepentan-3-yl)-4-chloro-3-fluorobenzamide (PubChem CID 107987793) has the molecular formula C12H14ClFN2OS and a molecular weight of 288.78 g/mol. Its IUPAC name is N-(1-amino-1-sulfanylidenepentan-3-yl)-4-chloro-3-fluorobenzamide.
| Compound Name | N-(1-amino-1-sulfanylidenepentan-3-yl)-4-chloro-3-fluorobenzamide |
|---|---|
| PubChem CID | 107987793 |
| Molecular Formula | C12H14ClFN2OS |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | N-(1-amino-1-sulfanylidenepentan-3-yl)-4-chloro-3-fluorobenzamide |
| SMILES | CCC(CC(N)=S)NC(=O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C12H14ClFN2OS/c1-2-8(6-11(15)18)16-12(17)7-3-4-9(13)10(14)5-7/h3-5,8H,2,6H2,1H3,(H2,15,18)(H,16,17) |
| InChIKey | DDPVYDQSVCBJNG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|