C8H3ClFIN2S — CID 107993537
2-(4-chloro-3-fluorophenyl)-5-iodo-1,3,4-thiadiazole (PubChem CID 107993537) has the molecular formula C8H3ClFIN2S and a molecular weight of 340.55 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-5-iodo-1,3,4-thiadiazole.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-5-iodo-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 107993537 |
| Molecular Formula | C8H3ClFIN2S |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 339.87 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-5-iodo-1,3,4-thiadiazole |
| SMILES | Fc1cc(-c2nnc(I)s2)ccc1Cl |
| InChI | InChI=1S/C8H3ClFIN2S/c9-5-2-1-4(3-6(5)10)7-12-13-8(11)14-7/h1-3H |
| InChIKey | KSVLECLXYRZSDV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|