C8H5IN2S — CID 63384141
2-iodo-5-phenyl-1,3,4-thiadiazole (PubChem CID 63384141) has the molecular formula C8H5IN2S and a molecular weight of 288.11 g/mol. Its IUPAC name is 2-iodo-5-phenyl-1,3,4-thiadiazole.
| Compound Name | 2-iodo-5-phenyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 63384141 |
| Molecular Formula | C8H5IN2S |
| Molecular Weight | 288.11 g/mol |
| Exact Mass | 287.92 |
| IUPAC Name | 2-iodo-5-phenyl-1,3,4-thiadiazole |
| SMILES | Ic1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C8H5IN2S/c9-8-11-10-7(12-8)6-4-2-1-3-5-6/h1-5H |
| InChIKey | IFVKWGPPUVZVRY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.11 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|