C16H11Cl2FN2 — CID 107999704
4-chloro-2-(4-chloro-3-fluorophenyl)-5,7-dimethylquinazoline (PubChem CID 107999704) has the molecular formula C16H11Cl2FN2 and a molecular weight of 321.18 g/mol. Its IUPAC name is 4-chloro-2-(4-chloro-3-fluorophenyl)-5,7-dimethylquinazoline.
| Compound Name | 4-chloro-2-(4-chloro-3-fluorophenyl)-5,7-dimethylquinazoline |
|---|---|
| PubChem CID | 107999704 |
| Molecular Formula | C16H11Cl2FN2 |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 4-chloro-2-(4-chloro-3-fluorophenyl)-5,7-dimethylquinazoline |
| SMILES | Cc1cc(C)c2c(Cl)nc(-c3ccc(Cl)c(F)c3)nc2c1 |
| InChI | InChI=1S/C16H11Cl2FN2/c1-8-5-9(2)14-13(6-8)20-16(21-15(14)18)10-3-4-11(17)12(19)7-10/h3-7H,1-2H3 |
| InChIKey | PKBCYZIYHVUQLB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |