C18H17ClN2 — CID 114589846
4-chloro-2-(3,5-dimethylphenyl)-5,7-dimethylquinazoline (PubChem CID 114589846) has the molecular formula C18H17ClN2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 4-chloro-2-(3,5-dimethylphenyl)-5,7-dimethylquinazoline.
| Compound Name | 4-chloro-2-(3,5-dimethylphenyl)-5,7-dimethylquinazoline |
|---|---|
| PubChem CID | 114589846 |
| Molecular Formula | C18H17ClN2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-chloro-2-(3,5-dimethylphenyl)-5,7-dimethylquinazoline |
| SMILES | Cc1cc(C)cc(-c2nc(Cl)c3c(C)cc(C)cc3n2)c1 |
| InChI | InChI=1S/C18H17ClN2/c1-10-5-11(2)8-14(7-10)18-20-15-9-12(3)6-13(4)16(15)17(19)21-18/h5-9H,1-4H3 |
| InChIKey | VGLOHUDLZHRSJO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |