C16H15NS — CID 10800880
4-methyl-2-(4-methylphenyl)-4H-3,1-benzothiazine (PubChem CID 10800880) has the molecular formula C16H15NS and a molecular weight of 253.37 g/mol. Its IUPAC name is 4-methyl-2-(4-methylphenyl)-4H-3,1-benzothiazine.
| Compound Name | 4-methyl-2-(4-methylphenyl)-4H-3,1-benzothiazine |
|---|---|
| PubChem CID | 10800880 |
| Molecular Formula | C16H15NS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-methyl-2-(4-methylphenyl)-4H-3,1-benzothiazine |
| SMILES | Cc1ccc(C2=Nc3ccccc3C(C)S2)cc1 |
| InChI | InChI=1S/C16H15NS/c1-11-7-9-13(10-8-11)16-17-15-6-4-3-5-14(15)12(2)18-16/h3-10,12H,1-2H3 |
| InChIKey | MOVHDTPCSGQOEG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |