C17H15ClN2S — CID 7912962
(6S)-6-(2-chlorophenyl)-4-(4-methylphenyl)-6H-1,3-thiazin-2-amine (PubChem CID 7912962) has the molecular formula C17H15ClN2S and a molecular weight of 314.84 g/mol. Its IUPAC name is (6S)-6-(2-chlorophenyl)-4-(4-methylphenyl)-6H-1,3-thiazin-2-amine.
| Compound Name | (6S)-6-(2-chlorophenyl)-4-(4-methylphenyl)-6H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 7912962 |
| Molecular Formula | C17H15ClN2S |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (6S)-6-(2-chlorophenyl)-4-(4-methylphenyl)-6H-1,3-thiazin-2-amine |
| SMILES | Cc1ccc(C2=C[C@@H](c3ccccc3Cl)SC(N)=N2)cc1 |
| InChI | InChI=1S/C17H15ClN2S/c1-11-6-8-12(9-7-11)15-10-16(21-17(19)20-15)13-4-2-3-5-14(13)18/h2-10,16H,1H3,(H2,19,20)/t16-/m0/s1 |
| InChIKey | NFKXKHOFPYWOSP-INIZCTEOSA-N |
| XLogP | 4.79 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |