C9H7ClN2OS — CID 40510286
(5R)-2-amino-5-(2-chlorophenyl)-1,3-thiazol-4-one (PubChem CID 40510286) has the molecular formula C9H7ClN2OS and a molecular weight of 226.69 g/mol. Its IUPAC name is (5R)-2-amino-5-(2-chlorophenyl)-1,3-thiazol-4-one.
| Compound Name | (5R)-2-amino-5-(2-chlorophenyl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 40510286 |
| Molecular Formula | C9H7ClN2OS |
| Molecular Weight | 226.69 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | (5R)-2-amino-5-(2-chlorophenyl)-1,3-thiazol-4-one |
| SMILES | NC1=NC(=O)[C@@H](c2ccccc2Cl)S1 |
| InChI | InChI=1S/C9H7ClN2OS/c10-6-4-2-1-3-5(6)7-8(13)12-9(11)14-7/h1-4,7H,(H2,11,12,13)/t7-/m1/s1 |
| InChIKey | TWJSQVWAFZYKCQ-SSDOTTSWSA-N |
| XLogP | 1.97 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.69 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |