C10H8Cl2N2OS — CID 2872891
2-amino-5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-4-one (PubChem CID 2872891) has the molecular formula C10H8Cl2N2OS and a molecular weight of 275.16 g/mol. Its IUPAC name is 2-amino-5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-4-one.
| Compound Name | 2-amino-5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 2872891 |
| Molecular Formula | C10H8Cl2N2OS |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 2-amino-5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-4-one |
| SMILES | NC1=NC(=O)C(Cc2ccc(Cl)c(Cl)c2)S1 |
| InChI | InChI=1S/C10H8Cl2N2OS/c11-6-2-1-5(3-7(6)12)4-8-9(15)14-10(13)16-8/h1-3,8H,4H2,(H2,13,14,15) |
| InChIKey | QWNJBVJZSOGVBU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |