C7H7Cl2N — CID 162352829
N,N-dideuterio-1-(3,4-dichlorophenyl)methanamine (PubChem CID 162352829) has the molecular formula C7H7Cl2N and a molecular weight of 178.06 g/mol. Its IUPAC name is N,N-dideuterio-1-(3,4-dichlorophenyl)methanamine.
| Compound Name | N,N-dideuterio-1-(3,4-dichlorophenyl)methanamine |
|---|---|
| PubChem CID | 162352829 |
| Molecular Formula | C7H7Cl2N |
| Molecular Weight | 178.06 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | N,N-dideuterio-1-(3,4-dichlorophenyl)methanamine |
| SMILES | [2H]N([2H])Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C7H7Cl2N/c8-6-2-1-5(4-10)3-7(6)9/h1-3H,4,10H2/i/hD2 |
| InChIKey | IXHNFOOSLAWRBQ-ZSJDYOACSA-N |
| XLogP | 2.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.06 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |