C7H7Cl2N — CID 162705454
(3,4-dichloro-5-deuteriophenyl)methanamine (PubChem CID 162705454) has the molecular formula C7H7Cl2N and a molecular weight of 177.05 g/mol. Its IUPAC name is (3,4-dichloro-5-deuteriophenyl)methanamine.
| Compound Name | (3,4-dichloro-5-deuteriophenyl)methanamine |
|---|---|
| PubChem CID | 162705454 |
| Molecular Formula | C7H7Cl2N |
| Molecular Weight | 177.05 g/mol |
| Exact Mass | 176.00 |
| IUPAC Name | (3,4-dichloro-5-deuteriophenyl)methanamine |
| SMILES | [2H]c1cc(CN)cc(Cl)c1Cl |
| InChI | InChI=1S/C7H7Cl2N/c8-6-2-1-5(4-10)3-7(6)9/h1-3H,4,10H2/i2D |
| InChIKey | IXHNFOOSLAWRBQ-VMNATFBRSA-N |
| XLogP | 2.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.05 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |