About 2-amino-5-(2,5-dimethoxyphenyl)-1,3-thiazol-4-one
2-amino-5-(2,5-dimethoxyphenyl)-1,3-thiazol-4-one (PubChem CID 71372820) has the molecular formula C11H12N2O3S
and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-amino-5-(2,5-dimethoxyphenyl)-1,3-thiazol-4-one.
Molecular Properties
| Compound Name | 2-amino-5-(2,5-dimethoxyphenyl)-1,3-thiazol-4-one |
| PubChem CID | 71372820 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2-amino-5-(2,5-dimethoxyphenyl)-1,3-thiazol-4-one |
| SMILES | COc1ccc(OC)c(C2SC(N)=NC2=O)c1 |
| InChI | InChI=1S/C11H12N2O3S/c1-15-6-3-4-8(16-2)7(5-6)9-10(14)13-11(12)17-9/h3-5,9H,1-2H3,(H2,12,13,14) |
| InChIKey | FBLZOUKCNYOBPV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-5-(2,5-dimethoxyphenyl)-1,3-thiazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-(2,5-dimethoxyphenyl)-1,3-thiazol-4-one?
The IUPAC name of 2-amino-5-(2,5-dimethoxyphenyl)-1,3-thiazol-4-one (CID 71372820) is 2-amino-5-(2,5-dimethoxyphenyl)-1,3-thiazol-4-one.
What is the SMILES notation for 2-amino-5-(2,5-dimethoxyphenyl)-1,3-thiazol-4-one?
The canonical SMILES for 2-amino-5-(2,5-dimethoxyphenyl)-1,3-thiazol-4-one is COc1ccc(OC)c(C2SC(N)=NC2=O)c1.
What is the InChIKey of 2-amino-5-(2,5-dimethoxyphenyl)-1,3-thiazol-4-one?
The InChIKey is FBLZOUKCNYOBPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3S/c1-15-6-3-4-8(16-2)7(5-6)9-10(14)13-11(12)17-9/h3-5,9H,1-2H3,(H2,12,13,14).
What are the key properties of 2-amino-5-(2,5-dimethoxyphenyl)-1,3-thiazol-4-one?
2-amino-5-(2,5-dimethoxyphenyl)-1,3-thiazol-4-one has a molecular weight of 252.29 g/mol, XLogP of 1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-(2,5-dimethoxyphenyl)-1,3-thiazol-4-one is sourced from PubChem (CID 71372820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).