About (5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one
(5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one (PubChem CID 139058923) has the molecular formula C11H12N2O3S
and a molecular weight of 252.29 g/mol. Its IUPAC name is (5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | (5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one |
| PubChem CID | 139058923 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | (5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1/NC(=O)[C@@H](c2cc(OC)ccc2OC)S1 |
| InChI | InChI=1S/C11H12N2O3S/c1-15-6-3-4-8(16-2)7(5-6)9-10(14)13-11(12)17-9/h3-5,9H,1-2H3,(H2,12,13,14)/t9-/m1/s1 |
| InChIKey | FBLZOUKCNYOBPV-SECBINFHSA-N |
| XLogP | 1.54 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one?
The IUPAC name of (5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one (CID 139058923) is (5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one.
What is the SMILES notation for (5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one?
The canonical SMILES for (5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one is [H]/N=C1/NC(=O)[C@@H](c2cc(OC)ccc2OC)S1.
What is the InChIKey of (5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one?
The InChIKey is FBLZOUKCNYOBPV-SECBINFHSA-N. The full InChI is InChI=1S/C11H12N2O3S/c1-15-6-3-4-8(16-2)7(5-6)9-10(14)13-11(12)17-9/h3-5,9H,1-2H3,(H2,12,13,14)/t9-/m1/s1.
What are the key properties of (5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one?
(5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one has a molecular weight of 252.29 g/mol, XLogP of 1.54, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one is sourced from PubChem (CID 139058923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).