C11H12N2O3S — CID 139058923
(5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one (PubChem CID 139058923) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is (5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one.
| Compound Name | (5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 139058923 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | (5R)-5-(2,5-dimethoxyphenyl)-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1/NC(=O)[C@@H](c2cc(OC)ccc2OC)S1 |
| InChI | InChI=1S/C11H12N2O3S/c1-15-6-3-4-8(16-2)7(5-6)9-10(14)13-11(12)17-9/h3-5,9H,1-2H3,(H2,12,13,14)/t9-/m1/s1 |
| InChIKey | FBLZOUKCNYOBPV-SECBINFHSA-N |
| XLogP | 1.54 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|