C12H12N2O2S2 — CID 140544647
2-imino-5-(6-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-1,3-thiazolidin-4-one (PubChem CID 140544647) has the molecular formula C12H12N2O2S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-imino-5-(6-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-1,3-thiazolidin-4-one.
| Compound Name | 2-imino-5-(6-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 140544647 |
| Molecular Formula | C12H12N2O2S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-imino-5-(6-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1/NC(=O)C(C2CSc3cc(OC)ccc32)S1 |
| InChI | InChI=1S/C12H12N2O2S2/c1-16-6-2-3-7-8(5-17-9(7)4-6)10-11(15)14-12(13)18-10/h2-4,8,10H,5H2,1H3,(H2,13,14,15) |
| InChIKey | UJRRTGPPEGIVDZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|