About 2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(4-methylphenyl)ethanone
2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(4-methylphenyl)ethanone (PubChem CID 132528824) has the molecular formula C23H20N2OS
and a molecular weight of 372.49 g/mol. Its IUPAC name is 2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(4-methylphenyl)ethanone.
Molecular Properties
| Compound Name | 2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(4-methylphenyl)ethanone |
| PubChem CID | 132528824 |
| Molecular Formula | C23H20N2OS |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(4-methylphenyl)ethanone |
| SMILES | Cc1ccc(C(=O)CC2SC(Nc3ccccc3)=Nc3ccccc32)cc1 |
| InChI | InChI=1S/C23H20N2OS/c1-16-11-13-17(14-12-16)21(26)15-22-19-9-5-6-10-20(19)25-23(27-22)24-18-7-3-2-4-8-18/h2-14,22H,15H2,1H3,(H,24,25) |
| InChIKey | ONLLBRJYVSKOPA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(4-methylphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(4-methylphenyl)ethanone?
The IUPAC name of 2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(4-methylphenyl)ethanone (CID 132528824) is 2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(4-methylphenyl)ethanone.
What is the SMILES notation for 2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(4-methylphenyl)ethanone?
The canonical SMILES for 2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(4-methylphenyl)ethanone is Cc1ccc(C(=O)CC2SC(Nc3ccccc3)=Nc3ccccc32)cc1.
What is the InChIKey of 2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(4-methylphenyl)ethanone?
The InChIKey is ONLLBRJYVSKOPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N2OS/c1-16-11-13-17(14-12-16)21(26)15-22-19-9-5-6-10-20(19)25-23(27-22)24-18-7-3-2-4-8-18/h2-14,22H,15H2,1H3,(H,24,25).
What are the key properties of 2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(4-methylphenyl)ethanone?
2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(4-methylphenyl)ethanone has a molecular weight of 372.49 g/mol, XLogP of 6.16, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(4-methylphenyl)ethanone is sourced from PubChem (CID 132528824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).