C23H20N2OS — CID 132528823
2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(3-methylphenyl)ethanone (PubChem CID 132528823) has the molecular formula C23H20N2OS and a molecular weight of 372.49 g/mol. Its IUPAC name is 2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(3-methylphenyl)ethanone.
| Compound Name | 2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 132528823 |
| Molecular Formula | C23H20N2OS |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-(2-anilino-4H-3,1-benzothiazin-4-yl)-1-(3-methylphenyl)ethanone |
| SMILES | Cc1cccc(C(=O)CC2SC(Nc3ccccc3)=Nc3ccccc32)c1 |
| InChI | InChI=1S/C23H20N2OS/c1-16-8-7-9-17(14-16)21(26)15-22-19-12-5-6-13-20(19)25-23(27-22)24-18-10-3-2-4-11-18/h2-14,22H,15H2,1H3,(H,24,25) |
| InChIKey | BAMJPJDMOYYDHT-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |