C15H29FOSi — CID 10802175
fluoro-[(1S)-1-[(4R,5E)-hepta-1,5-dien-4-yl]oxyhexyl]-dimethylsilane (PubChem CID 10802175) has the molecular formula C15H29FOSi and a molecular weight of 272.48 g/mol. Its IUPAC name is fluoro-[(1S)-1-[(4R,5E)-hepta-1,5-dien-4-yl]oxyhexyl]-dimethylsilane.
| Compound Name | fluoro-[(1S)-1-[(4R,5E)-hepta-1,5-dien-4-yl]oxyhexyl]-dimethylsilane |
|---|---|
| PubChem CID | 10802175 |
| Molecular Formula | C15H29FOSi |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | fluoro-[(1S)-1-[(4R,5E)-hepta-1,5-dien-4-yl]oxyhexyl]-dimethylsilane |
| SMILES | C=CC[C@H](/C=C/C)O[C@H](CCCCC)[Si](C)(C)F |
| InChI | InChI=1S/C15H29FOSi/c1-6-9-10-13-15(18(4,5)16)17-14(11-7-2)12-8-3/h7-8,12,14-15H,2,6,9-11,13H2,1,3-5H3/b12-8+/t14-,15+/m1/s1 |
| InChIKey | VVOSRAYQOPCFDG-QQAGXBGCSA-N |
| XLogP | 5.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|