C16H18N2OS — CID 10803148
(2S,3S)-2-(imidazol-1-ylmethyl)-2,3,5,6,7,8-hexahydrobenzo[f][1]benzothiol-3-ol (PubChem CID 10803148) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is (2S,3S)-2-(imidazol-1-ylmethyl)-2,3,5,6,7,8-hexahydrobenzo[f][1]benzothiol-3-ol.
| Compound Name | (2S,3S)-2-(imidazol-1-ylmethyl)-2,3,5,6,7,8-hexahydrobenzo[f][1]benzothiol-3-ol |
|---|---|
| PubChem CID | 10803148 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (2S,3S)-2-(imidazol-1-ylmethyl)-2,3,5,6,7,8-hexahydrobenzo[f][1]benzothiol-3-ol |
| SMILES | O[C@H]1c2cc3c(cc2S[C@H]1Cn1ccnc1)CCCC3 |
| InChI | InChI=1S/C16H18N2OS/c19-16-13-7-11-3-1-2-4-12(11)8-14(13)20-15(16)9-18-6-5-17-10-18/h5-8,10,15-16,19H,1-4,9H2/t15-,16-/m0/s1 |
| InChIKey | CHNOAHYYZLYAMP-HOTGVXAUSA-N |
| XLogP | 2.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |