C17H20N2O — CID 54213176
(1S,2S)-2-(imidazol-1-ylmethyl)-2,3,3a,4,5,6-hexahydro-1H-phenalen-1-ol (PubChem CID 54213176) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (1S,2S)-2-(imidazol-1-ylmethyl)-2,3,3a,4,5,6-hexahydro-1H-phenalen-1-ol.
| Compound Name | (1S,2S)-2-(imidazol-1-ylmethyl)-2,3,3a,4,5,6-hexahydro-1H-phenalen-1-ol |
|---|---|
| PubChem CID | 54213176 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (1S,2S)-2-(imidazol-1-ylmethyl)-2,3,3a,4,5,6-hexahydro-1H-phenalen-1-ol |
| SMILES | O[C@@H]1c2cccc3c2C(CCC3)C[C@H]1Cn1ccnc1 |
| InChI | InChI=1S/C17H20N2O/c20-17-14(10-19-8-7-18-11-19)9-13-5-1-3-12-4-2-6-15(17)16(12)13/h2,4,6-8,11,13-14,17,20H,1,3,5,9-10H2/t13?,14-,17-/m0/s1 |
| InChIKey | PXISOBXHBYVAHY-HUUYTVAOSA-N |
| XLogP | 3.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |