C17H22O4 — CID 10803435
[(1S,2R,3R,6S,7R,8R)-7-(hydroxymethyl)-6-methyl-15,16-dioxapentacyclo[6.6.1.13,6.01,10.02,7]hexadeca-4,9-dien-2-yl]methanol (PubChem CID 10803435) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is [(1S,2R,3R,6S,7R,8R)-7-(hydroxymethyl)-6-methyl-15,16-dioxapentacyclo[6.6.1.13,6.01,10.02,7]hexadeca-4,9-dien-2-yl]methanol.
| Compound Name | [(1S,2R,3R,6S,7R,8R)-7-(hydroxymethyl)-6-methyl-15,16-dioxapentacyclo[6.6.1.13,6.01,10.02,7]hexadeca-4,9-dien-2-yl]methanol |
|---|---|
| PubChem CID | 10803435 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [(1S,2R,3R,6S,7R,8R)-7-(hydroxymethyl)-6-methyl-15,16-dioxapentacyclo[6.6.1.13,6.01,10.02,7]hexadeca-4,9-dien-2-yl]methanol |
| SMILES | C[C@@]12C=C[C@@H](O1)[C@]1(CO)[C@@]2(CO)[C@H]2C=C3CCCC[C@]31O2 |
| InChI | InChI=1S/C17H22O4/c1-14-7-5-12(20-14)16(10-19)15(14,9-18)13-8-11-4-2-3-6-17(11,16)21-13/h5,7-8,12-13,18-19H,2-4,6,9-10H2,1H3/t12-,13-,14+,15+,16-,17+/m1/s1 |
| InChIKey | QSGLJLMOWXNEIT-BPXZUEPWSA-N |
| XLogP | 1.32 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|