C17H19N3O2 — CID 10803956
(1R,8S)-4,5,11,14,15-pentamethyl-9,11,13-triazatetracyclo[6.5.2.02,7.09,13]pentadeca-2(7),3,5,14-tetraene-10,12-dione (PubChem CID 10803956) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is (1R,8S)-4,5,11,14,15-pentamethyl-9,11,13-triazatetracyclo[6.5.2.02,7.09,13]pentadeca-2(7),3,5,14-tetraene-10,12-dione.
| Compound Name | (1R,8S)-4,5,11,14,15-pentamethyl-9,11,13-triazatetracyclo[6.5.2.02,7.09,13]pentadeca-2(7),3,5,14-tetraene-10,12-dione |
|---|---|
| PubChem CID | 10803956 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (1R,8S)-4,5,11,14,15-pentamethyl-9,11,13-triazatetracyclo[6.5.2.02,7.09,13]pentadeca-2(7),3,5,14-tetraene-10,12-dione |
| SMILES | CC1=C(C)[C@H]2c3cc(C)c(C)cc3[C@@H]1n1c(=O)n(C)c(=O)n12 |
| InChI | InChI=1S/C17H19N3O2/c1-8-6-12-13(7-9(8)2)15-11(4)10(3)14(12)19-16(21)18(5)17(22)20(15)19/h6-7,14-15H,1-5H3/t14-,15+ |
| InChIKey | REDFTPBBMCFMGT-GASCZTMLSA-N |
| XLogP | 1.81 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|