C16H20O7 — CID 10805898
dimethyl 4-(2,2-dimethylpropanoyloxymethyl)-2-hydroxybenzene-1,3-dicarboxylate (PubChem CID 10805898) has the molecular formula C16H20O7 and a molecular weight of 324.33 g/mol. Its IUPAC name is dimethyl 4-(2,2-dimethylpropanoyloxymethyl)-2-hydroxybenzene-1,3-dicarboxylate.
| Compound Name | dimethyl 4-(2,2-dimethylpropanoyloxymethyl)-2-hydroxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 10805898 |
| Molecular Formula | C16H20O7 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | dimethyl 4-(2,2-dimethylpropanoyloxymethyl)-2-hydroxybenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)C(C)(C)C)c(C(=O)OC)c1O |
| InChI | InChI=1S/C16H20O7/c1-16(2,3)15(20)23-8-9-6-7-10(13(18)21-4)12(17)11(9)14(19)22-5/h6-7,17H,8H2,1-5H3 |
| InChIKey | ZPWCNTFLAXQFKF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|