About [4-(2,2-dimethylpropylamino)-2-methylphenyl]methyl 2,2-dimethylpropanoate
[4-(2,2-dimethylpropylamino)-2-methylphenyl]methyl 2,2-dimethylpropanoate (PubChem CID 158338817) has the molecular formula C18H29NO2
and a molecular weight of 291.44 g/mol. Its IUPAC name is [4-(2,2-dimethylpropylamino)-2-methylphenyl]methyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [4-(2,2-dimethylpropylamino)-2-methylphenyl]methyl 2,2-dimethylpropanoate |
| PubChem CID | 158338817 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | [4-(2,2-dimethylpropylamino)-2-methylphenyl]methyl 2,2-dimethylpropanoate |
| SMILES | Cc1cc(NCC(C)(C)C)ccc1COC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H29NO2/c1-13-10-15(19-12-17(2,3)4)9-8-14(13)11-21-16(20)18(5,6)7/h8-10,19H,11-12H2,1-7H3 |
| InChIKey | NYEKSZXPOYUCLN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(2,2-dimethylpropylamino)-2-methylphenyl]methyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,2-dimethylpropylamino)-2-methylphenyl]methyl 2,2-dimethylpropanoate?
The IUPAC name of [4-(2,2-dimethylpropylamino)-2-methylphenyl]methyl 2,2-dimethylpropanoate (CID 158338817) is [4-(2,2-dimethylpropylamino)-2-methylphenyl]methyl 2,2-dimethylpropanoate.
What is the SMILES notation for [4-(2,2-dimethylpropylamino)-2-methylphenyl]methyl 2,2-dimethylpropanoate?
The canonical SMILES for [4-(2,2-dimethylpropylamino)-2-methylphenyl]methyl 2,2-dimethylpropanoate is Cc1cc(NCC(C)(C)C)ccc1COC(=O)C(C)(C)C.
What is the InChIKey of [4-(2,2-dimethylpropylamino)-2-methylphenyl]methyl 2,2-dimethylpropanoate?
The InChIKey is NYEKSZXPOYUCLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO2/c1-13-10-15(19-12-17(2,3)4)9-8-14(13)11-21-16(20)18(5,6)7/h8-10,19H,11-12H2,1-7H3.
What are the key properties of [4-(2,2-dimethylpropylamino)-2-methylphenyl]methyl 2,2-dimethylpropanoate?
[4-(2,2-dimethylpropylamino)-2-methylphenyl]methyl 2,2-dimethylpropanoate has a molecular weight of 291.44 g/mol, XLogP of 4.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,2-dimethylpropylamino)-2-methylphenyl]methyl 2,2-dimethylpropanoate is sourced from PubChem (CID 158338817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).