C21H25NO3Si — CID 10808994
(4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-1-azabicyclo[3.1.0]hexan-2-one (PubChem CID 10808994) has the molecular formula C21H25NO3Si and a molecular weight of 367.52 g/mol. Its IUPAC name is (4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-1-azabicyclo[3.1.0]hexan-2-one.
| Compound Name | (4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-1-azabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 10808994 |
| Molecular Formula | C21H25NO3Si |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-1-azabicyclo[3.1.0]hexan-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1OC(=O)N2C[C@H]12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO3Si/c1-21(2,3)26(16-10-6-4-7-11-16,17-12-8-5-9-13-17)24-15-19-18-14-22(18)20(23)25-19/h4-13,18-19H,14-15H2,1-3H3/t18-,19-,22?/m1/s1 |
| InChIKey | BSESSNWHJXZIDW-IERKJGKXSA-N |
| XLogP | 2.77 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|