C21H27NO3Si — CID 58756451
(5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-1,3-oxazolidin-2-one (PubChem CID 58756451) has the molecular formula C21H27NO3Si and a molecular weight of 369.54 g/mol. Its IUPAC name is (5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 58756451 |
| Molecular Formula | C21H27NO3Si |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-1,3-oxazolidin-2-one |
| SMILES | CN1C[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C21H27NO3Si/c1-21(2,3)26(18-11-7-5-8-12-18,19-13-9-6-10-14-19)24-16-17-15-22(4)20(23)25-17/h5-14,17H,15-16H2,1-4H3/t17-/m1/s1 |
| InChIKey | RJJMKBVWJATQSV-QGZVFWFLSA-N |
| XLogP | 3.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|