C24H34N2O3S — CID 10812559
ethyl (3R)-8-phenyl-4-(2-piperidin-1-ylacetyl)-1-thia-4-azaspiro[4.5]decane-3-carboxylate (PubChem CID 10812559) has the molecular formula C24H34N2O3S and a molecular weight of 430.61 g/mol. Its IUPAC name is ethyl (3R)-8-phenyl-4-(2-piperidin-1-ylacetyl)-1-thia-4-azaspiro[4.5]decane-3-carboxylate.
| Compound Name | ethyl (3R)-8-phenyl-4-(2-piperidin-1-ylacetyl)-1-thia-4-azaspiro[4.5]decane-3-carboxylate |
|---|---|
| PubChem CID | 10812559 |
| Molecular Formula | C24H34N2O3S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | ethyl (3R)-8-phenyl-4-(2-piperidin-1-ylacetyl)-1-thia-4-azaspiro[4.5]decane-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CSC2(CCC(c3ccccc3)CC2)N1C(=O)CN1CCCCC1 |
| InChI | InChI=1S/C24H34N2O3S/c1-2-29-23(28)21-18-30-24(26(21)22(27)17-25-15-7-4-8-16-25)13-11-20(12-14-24)19-9-5-3-6-10-19/h3,5-6,9-10,20-21H,2,4,7-8,11-18H2,1H3/t20?,21-,24?/m0/s1 |
| InChIKey | BPBHRUUSWOADET-DQBMGFJSSA-N |
| XLogP | 4.03 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |