C15H23NO4S — CID 11674036
ethyl (4R)-3-(2-cyclopentyl-2-oxoacetyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylate (PubChem CID 11674036) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is ethyl (4R)-3-(2-cyclopentyl-2-oxoacetyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | ethyl (4R)-3-(2-cyclopentyl-2-oxoacetyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 11674036 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | ethyl (4R)-3-(2-cyclopentyl-2-oxoacetyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CSC(C)(C)N1C(=O)C(=O)C1CCCC1 |
| InChI | InChI=1S/C15H23NO4S/c1-4-20-14(19)11-9-21-15(2,3)16(11)13(18)12(17)10-7-5-6-8-10/h10-11H,4-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | DSVQNOUQPZLCEU-NSHDSACASA-N |
| XLogP | 1.99 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|