C22H31NO5S — CID 11697479
3-phenoxypropyl (4R)-3-(3,3-dimethyl-2-oxopentanoyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylate (PubChem CID 11697479) has the molecular formula C22H31NO5S and a molecular weight of 421.56 g/mol. Its IUPAC name is 3-phenoxypropyl (4R)-3-(3,3-dimethyl-2-oxopentanoyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | 3-phenoxypropyl (4R)-3-(3,3-dimethyl-2-oxopentanoyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 11697479 |
| Molecular Formula | C22H31NO5S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 3-phenoxypropyl (4R)-3-(3,3-dimethyl-2-oxopentanoyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1[C@H](C(=O)OCCCOc2ccccc2)CSC1(C)C |
| InChI | InChI=1S/C22H31NO5S/c1-6-21(2,3)18(24)19(25)23-17(15-29-22(23,4)5)20(26)28-14-10-13-27-16-11-8-7-9-12-16/h7-9,11-12,17H,6,10,13-15H2,1-5H3/t17-/m0/s1 |
| InChIKey | RBBNZWYTSNRJLN-KRWDZBQOSA-N |
| XLogP | 3.68 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|