C26H28N2O2S — CID 10812646
N-[(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]benzenesulfonamide (PubChem CID 10812646) has the molecular formula C26H28N2O2S and a molecular weight of 432.59 g/mol. Its IUPAC name is N-[(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]benzenesulfonamide.
| Compound Name | N-[(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10812646 |
| Molecular Formula | C26H28N2O2S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | N-[(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@H]1C2CCN(CC2)[C@H]1C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28N2O2S/c29-31(30,23-14-8-3-9-15-23)27-25-22-16-18-28(19-17-22)26(25)24(20-10-4-1-5-11-20)21-12-6-2-7-13-21/h1-15,22,24-27H,16-19H2/t25-,26-/m0/s1 |
| InChIKey | XDUINQTYZZSOSK-UIOOFZCWSA-N |
| XLogP | 4.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |