C20H24N2 — CID 67790073
(3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 67790073) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is (3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | (3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 67790073 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | N[C@@H]1C2CCN(CC2)C1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24N2/c21-19-17-11-13-22(14-12-17)20(19)18(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17-20H,11-14,21H2/t19-,20?/m1/s1 |
| InChIKey | MECDCHFRZHLREI-FIWHBWSRSA-N |
| XLogP | 3.24 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |