C28H28N2O2 — CID 67825710
2-[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]iminomethyl]benzoic acid (PubChem CID 67825710) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is 2-[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]iminomethyl]benzoic acid.
| Compound Name | 2-[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]iminomethyl]benzoic acid |
|---|---|
| PubChem CID | 67825710 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 2-[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]iminomethyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1/C=N/[C@@H]1C2CCN(CC2)[C@H]1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H28N2O2/c31-28(32)24-14-8-7-13-23(24)19-29-26-22-15-17-30(18-16-22)27(26)25(20-9-3-1-4-10-20)21-11-5-2-6-12-21/h1-14,19,22,25-27H,15-18H2,(H,31,32)/b29-19+/t26-,27+/m1/s1 |
| InChIKey | PTBMYDCHRHWVOM-SZUNQTJJSA-N |
| XLogP | 5.10 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|